About 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine
1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine (PubChem CID 20533054) has the molecular formula C18H18Cl2N2
and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine |
| PubChem CID | 20533054 |
| Molecular Formula | C18H18Cl2N2 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine |
| SMILES | ClCCN1c2ccccc2C(c2ccccc2)=NCC1CCl |
| InChI | InChI=1S/C18H18Cl2N2/c19-10-11-22-15(12-20)13-21-18(14-6-2-1-3-7-14)16-8-4-5-9-17(16)22/h1-9,15H,10-13H2 |
| InChIKey | KUEHLWULHYJMNT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine?
The IUPAC name of 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine (CID 20533054) is 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine.
What is the SMILES notation for 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine?
The canonical SMILES for 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine is ClCCN1c2ccccc2C(c2ccccc2)=NCC1CCl.
What is the InChIKey of 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine?
The InChIKey is KUEHLWULHYJMNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N2/c19-10-11-22-15(12-20)13-21-18(14-6-2-1-3-7-14)16-8-4-5-9-17(16)22/h1-9,15H,10-13H2.
What are the key properties of 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine?
1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine has a molecular weight of 333.26 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-2-(chloromethyl)-5-phenyl-2,3-dihydro-1,4-benzodiazepine is sourced from PubChem (CID 20533054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).