About formaldehyde;2-oxoacetamide
formaldehyde;2-oxoacetamide (PubChem CID 20534521) has the molecular formula C3H5NO3
and a molecular weight of 103.08 g/mol. Its IUPAC name is formaldehyde;2-oxoacetamide.
Molecular Properties
| Compound Name | formaldehyde;2-oxoacetamide |
| PubChem CID | 20534521 |
| Molecular Formula | C3H5NO3 |
| Molecular Weight | 103.08 g/mol |
| Exact Mass | 103.03 |
| IUPAC Name | formaldehyde;2-oxoacetamide |
| SMILES | C=O.NC(=O)C=O |
| InChI | InChI=1S/C2H3NO2.CH2O/c3-2(5)1-4;1-2/h1H,(H2,3,5);1H2 |
| InChIKey | RFWICLUAPQEJBB-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.08 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-oxoacetamide?
The IUPAC name of formaldehyde;2-oxoacetamide (CID 20534521) is formaldehyde;2-oxoacetamide.
What is the SMILES notation for formaldehyde;2-oxoacetamide?
The canonical SMILES for formaldehyde;2-oxoacetamide is C=O.NC(=O)C=O.
What is the InChIKey of formaldehyde;2-oxoacetamide?
The InChIKey is RFWICLUAPQEJBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO2.CH2O/c3-2(5)1-4;1-2/h1H,(H2,3,5);1H2.
What are the key properties of formaldehyde;2-oxoacetamide?
formaldehyde;2-oxoacetamide has a molecular weight of 103.08 g/mol, XLogP of -1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-oxoacetamide is sourced from PubChem (CID 20534521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).