About 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea
1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea (PubChem CID 20534524) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea.
Molecular Properties
| Compound Name | 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea |
| PubChem CID | 20534524 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea |
| SMILES | CC(C)c1cc(NC(=O)N(C)C)no1 |
| InChI | InChI=1S/C9H15N3O2/c1-6(2)7-5-8(11-14-7)10-9(13)12(3)4/h5-6H,1-4H3,(H,10,11,13) |
| InChIKey | ISORSPZEVHZPDM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea?
The IUPAC name of 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea (CID 20534524) is 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea.
What is the SMILES notation for 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea?
The canonical SMILES for 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea is CC(C)c1cc(NC(=O)N(C)C)no1.
What is the InChIKey of 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea?
The InChIKey is ISORSPZEVHZPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6(2)7-5-8(11-14-7)10-9(13)12(3)4/h5-6H,1-4H3,(H,10,11,13).
What are the key properties of 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea?
1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea has a molecular weight of 197.24 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethyl-3-(5-propan-2-yl-1,2-oxazol-3-yl)urea is sourced from PubChem (CID 20534524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).