C8H12N6O — CID 20535091
4-(3,6-dihydro-2H-pyridin-1-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine (PubChem CID 20535091) has the molecular formula C8H12N6O and a molecular weight of 208.22 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridin-1-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine.
| Compound Name | 4-(3,6-dihydro-2H-pyridin-1-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 20535091 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridin-1-yl)-1-hydroxy-6-imino-1,3,5-triazin-2-amine |
| SMILES | [H]/N=c1\nc(N2CC=CCC2)nc(N)n1O |
| InChI | InChI=1S/C8H12N6O/c9-6-11-8(12-7(10)14(6)15)13-4-2-1-3-5-13/h1-2,15H,3-5H2,(H3,9,10,11,12) |
| InChIKey | XDHKNIUCIXIFRM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|