C8H12N6 — CID 20535131
6-(3,6-dihydro-2H-pyridin-1-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 20535131) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 20535131 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(N2CC=CCC2)n1 |
| InChI | InChI=1S/C8H12N6/c9-6-11-7(10)13-8(12-6)14-4-2-1-3-5-14/h1-2H,3-5H2,(H4,9,10,11,12,13) |
| InChIKey | VPLVWSPXDCSNQI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|