About [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate
[5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate (PubChem CID 20535240) has the molecular formula C19H28O5
and a molecular weight of 336.43 g/mol. Its IUPAC name is [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate.
Molecular Properties
| Compound Name | [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate |
| PubChem CID | 20535240 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate |
| SMILES | CC(=O)C1=CC=CC(COC(=O)CC(C)C)(OC(=O)CC(C)C)C1 |
| InChI | InChI=1S/C19H28O5/c1-13(2)9-17(21)23-12-19(24-18(22)10-14(3)4)8-6-7-16(11-19)15(5)20/h6-8,13-14H,9-12H2,1-5H3 |
| InChIKey | WBTYKNQPVWLSFF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate?
The IUPAC name of [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate (CID 20535240) is [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate.
What is the SMILES notation for [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate?
The canonical SMILES for [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate is CC(=O)C1=CC=CC(COC(=O)CC(C)C)(OC(=O)CC(C)C)C1.
What is the InChIKey of [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate?
The InChIKey is WBTYKNQPVWLSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O5/c1-13(2)9-17(21)23-12-19(24-18(22)10-14(3)4)8-6-7-16(11-19)15(5)20/h6-8,13-14H,9-12H2,1-5H3.
What are the key properties of [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate?
[5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate has a molecular weight of 336.43 g/mol, XLogP of 3.38, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-acetyl-1-(3-methylbutanoyloxy)cyclohexa-2,4-dien-1-yl]methyl 3-methylbutanoate is sourced from PubChem (CID 20535240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).