C31H44NO9S- — CID 20535337
N,N-dimethylbenzamide;[2-(2,2-dimethylpentanoyloxy)-4-formylphenyl] 2,2-dimethylpentanoate;methanesulfonate (PubChem CID 20535337) has the molecular formula C31H44NO9S- and a molecular weight of 606.76 g/mol. Its IUPAC name is N,N-dimethylbenzamide;[2-(2,2-dimethylpentanoyloxy)-4-formylphenyl] 2,2-dimethylpentanoate;methanesulfonate.
| Compound Name | N,N-dimethylbenzamide;[2-(2,2-dimethylpentanoyloxy)-4-formylphenyl] 2,2-dimethylpentanoate;methanesulfonate |
|---|---|
| PubChem CID | 20535337 |
| Molecular Formula | C31H44NO9S- |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | N,N-dimethylbenzamide;[2-(2,2-dimethylpentanoyloxy)-4-formylphenyl] 2,2-dimethylpentanoate;methanesulfonate |
| SMILES | CCCC(C)(C)C(=O)Oc1ccc(C=O)cc1OC(=O)C(C)(C)CCC.CN(C)C(=O)c1ccccc1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C21H30O5.C9H11NO.CH4O3S/c1-7-11-20(3,4)18(23)25-16-10-9-15(14-22)13-17(16)26-19(24)21(5,6)12-8-2;1-10(2)9(11)8-6-4-3-5-7-8;1-5(2,3)4/h9-10,13-14H,7-8,11-12H2,1-6H3;3-7H,1-2H3;1H3,(H,2,3,4)/p-1 |
| InChIKey | QKWUDMRUECMJOP-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|