About 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol
1-(4-methylphenyl)sulfonylpropane-1,2,3-triol (PubChem CID 20535709) has the molecular formula C10H14O5S
and a molecular weight of 246.28 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol |
| PubChem CID | 20535709 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol |
| SMILES | Cc1ccc(S(=O)(=O)C(O)C(O)CO)cc1 |
| InChI | InChI=1S/C10H14O5S/c1-7-2-4-8(5-3-7)16(14,15)10(13)9(12)6-11/h2-5,9-13H,6H2,1H3 |
| InChIKey | NRALXSXRXXJAFJ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol?
The IUPAC name of 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol (CID 20535709) is 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol.
What is the SMILES notation for 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol?
The canonical SMILES for 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol is Cc1ccc(S(=O)(=O)C(O)C(O)CO)cc1.
What is the InChIKey of 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol?
The InChIKey is NRALXSXRXXJAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5S/c1-7-2-4-8(5-3-7)16(14,15)10(13)9(12)6-11/h2-5,9-13H,6H2,1H3.
What are the key properties of 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol?
1-(4-methylphenyl)sulfonylpropane-1,2,3-triol has a molecular weight of 246.28 g/mol, XLogP of -0.56, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)sulfonylpropane-1,2,3-triol is sourced from PubChem (CID 20535709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).