C15H25Cl2N5O — CID 20536071
4,6-dichloro-N-(2-methoxyethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 20536071) has the molecular formula C15H25Cl2N5O and a molecular weight of 362.31 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-methoxyethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2-methoxyethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 20536071 |
| Molecular Formula | C15H25Cl2N5O |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 4,6-dichloro-N-(2-methoxyethyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | COCCN(c1nc(Cl)nc(Cl)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H25Cl2N5O/c1-14(2)8-10(9-15(3,4)21-14)22(6-7-23-5)13-19-11(16)18-12(17)20-13/h10,21H,6-9H2,1-5H3 |
| InChIKey | HGCZGNZFFTWZIM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |