About 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate
2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate (PubChem CID 20536133) has the molecular formula C23H27F3O5S
and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate |
| PubChem CID | 20536133 |
| Molecular Formula | C23H27F3O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate |
| SMILES | CCc1cc(C(F)(F)F)ccc1S(=O)(=O)c1ccc(OC(CC)C(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C23H27F3O5S/c1-5-16-13-17(23(24,25)26)7-12-21(16)32(28,29)19-10-8-18(9-11-19)31-20(6-2)22(27)30-14-15(3)4/h7-13,15,20H,5-6,14H2,1-4H3 |
| InChIKey | FAYJIGWNCDIWIJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate?
The IUPAC name of 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate (CID 20536133) is 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate.
What is the SMILES notation for 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate?
The canonical SMILES for 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate is CCc1cc(C(F)(F)F)ccc1S(=O)(=O)c1ccc(OC(CC)C(=O)OCC(C)C)cc1.
What is the InChIKey of 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate?
The InChIKey is FAYJIGWNCDIWIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27F3O5S/c1-5-16-13-17(23(24,25)26)7-12-21(16)32(28,29)19-10-8-18(9-11-19)31-20(6-2)22(27)30-14-15(3)4/h7-13,15,20H,5-6,14H2,1-4H3.
What are the key properties of 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate?
2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate has a molecular weight of 472.53 g/mol, XLogP of 5.46, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-[4-[2-ethyl-4-(trifluoromethyl)phenyl]sulfonylphenoxy]butanoate is sourced from PubChem (CID 20536133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).