About 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide (PubChem CID 20536252) has the molecular formula C18H32BrN
and a molecular weight of 342.37 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide.
Molecular Properties
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide |
| PubChem CID | 20536252 |
| Molecular Formula | C18H32BrN |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide |
| SMILES | C=CC[N+]1(C/C=C(\C)CCC=C(C)C)CCCCC1.[Br-] |
| InChI | InChI=1S/C18H32N.BrH/c1-5-13-19(14-7-6-8-15-19)16-12-18(4)11-9-10-17(2)3;/h5,10,12H,1,6-9,11,13-16H2,2-4H3;1H/q+1;/p-1/b18-12+; |
| InChIKey | GVTFHLMKVONWHX-XMMWENQYSA-M |
| XLogP | 1.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide?
The IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide (CID 20536252) is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide.
What is the SMILES notation for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide?
The canonical SMILES for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide is C=CC[N+]1(C/C=C(\C)CCC=C(C)C)CCCCC1.[Br-].
What is the InChIKey of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide?
The InChIKey is GVTFHLMKVONWHX-XMMWENQYSA-M. The full InChI is InChI=1S/C18H32N.BrH/c1-5-13-19(14-7-6-8-15-19)16-12-18(4)11-9-10-17(2)3;/h5,10,12H,1,6-9,11,13-16H2,2-4H3;1H/q+1;/p-1/b18-12+;.
What are the key properties of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide?
1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide has a molecular weight of 342.37 g/mol, XLogP of 1.87, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-prop-2-enylpiperidin-1-ium bromide is sourced from PubChem (CID 20536252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).