C26H33N6O3+ — CID 20536399
2-N-[1-(4-pyridin-3-ylpiperidin-1-ium-1-ylidene)ethyl]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 20536399) has the molecular formula C26H33N6O3+ and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-N-[1-(4-pyridin-3-ylpiperidin-1-ium-1-ylidene)ethyl]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[1-(4-pyridin-3-ylpiperidin-1-ium-1-ylidene)ethyl]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 20536399 |
| Molecular Formula | C26H33N6O3+ |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 2-N-[1-(4-pyridin-3-ylpiperidin-1-ium-1-ylidene)ethyl]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cc2cnc(NC(C)=[N+]3CCC(c4cccnc4)CC3)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C26H32N6O3/c1-17(32-10-7-19(8-11-32)20-6-5-9-28-15-20)30-26-29-16-21(25(27)31-26)12-18-13-22(33-2)24(35-4)23(14-18)34-3/h5-6,9,13-16,19H,7-8,10-12H2,1-4H3,(H2,27,29,31)/p+1 |
| InChIKey | PSFCPFWDRCCOEM-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|