About 1a-phenyloxireno[2,3-b]chromene
1a-phenyloxireno[2,3-b]chromene (PubChem CID 20536923) has the molecular formula C15H10O2
and a molecular weight of 222.24 g/mol. Its IUPAC name is 1a-phenyloxireno[2,3-b]chromene.
Molecular Properties
| Compound Name | 1a-phenyloxireno[2,3-b]chromene |
| PubChem CID | 20536923 |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1a-phenyloxireno[2,3-b]chromene |
| SMILES | C1=C2OC2(c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C15H10O2/c1-2-7-12(8-3-1)15-14(17-15)10-11-6-4-5-9-13(11)16-15/h1-10H |
| InChIKey | GQDAKAZKQXEZCR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1a-phenyloxireno[2,3-b]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1a-phenyloxireno[2,3-b]chromene?
The IUPAC name of 1a-phenyloxireno[2,3-b]chromene (CID 20536923) is 1a-phenyloxireno[2,3-b]chromene.
What is the SMILES notation for 1a-phenyloxireno[2,3-b]chromene?
The canonical SMILES for 1a-phenyloxireno[2,3-b]chromene is C1=C2OC2(c2ccccc2)Oc2ccccc21.
What is the InChIKey of 1a-phenyloxireno[2,3-b]chromene?
The InChIKey is GQDAKAZKQXEZCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O2/c1-2-7-12(8-3-1)15-14(17-15)10-11-6-4-5-9-13(11)16-15/h1-10H.
What are the key properties of 1a-phenyloxireno[2,3-b]chromene?
1a-phenyloxireno[2,3-b]chromene has a molecular weight of 222.24 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1a-phenyloxireno[2,3-b]chromene is sourced from PubChem (CID 20536923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).