About N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide
N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide (PubChem CID 2053712) has the molecular formula C8H16N2O2S
and a molecular weight of 204.29 g/mol. Its IUPAC name is N-[2-(2-acetamidoethylsulfanyl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide |
| PubChem CID | 2053712 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-[2-(2-acetamidoethylsulfanyl)ethyl]acetamide |
| SMILES | CC(=O)NCCSCCNC(=O)C |
| InChI | InChI=1S/C8H16N2O2S/c1-7(11)9-3-5-13-6-4-10-8(2)12/h3-6H2,1-2H3,(H,9,11)(H,10,12) |
| InChIKey | MTKKSVZRQYFVME-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | 156 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide?
The IUPAC name of N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide (CID 2053712) is N-[2-(2-acetamidoethylsulfanyl)ethyl]acetamide.
What is the SMILES notation for N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide?
The canonical SMILES for N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide is CC(=O)NCCSCCNC(=O)C.
What is the InChIKey of N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide?
The InChIKey is MTKKSVZRQYFVME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2S/c1-7(11)9-3-5-13-6-4-10-8(2)12/h3-6H2,1-2H3,(H,9,11)(H,10,12).
What are the key properties of N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide?
N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide has a molecular weight of 204.29 g/mol, XLogP of -0.50, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-{2-[(2-Acetamidoethyl)sulfanyl]ethyl}acetamide is sourced from PubChem (CID 2053712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).