About 2,2-dihexylbenzimidazole
2,2-dihexylbenzimidazole (PubChem CID 20537646) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 2,2-dihexylbenzimidazole.
Molecular Properties
| Compound Name | 2,2-dihexylbenzimidazole |
| PubChem CID | 20537646 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 2,2-dihexylbenzimidazole |
| SMILES | CCCCCCC1(CCCCCC)N=c2ccccc2=N1 |
| InChI | InChI=1S/C19H30N2/c1-3-5-7-11-15-19(16-12-8-6-4-2)20-17-13-9-10-14-18(17)21-19/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | IOUDMJJZSFBMHM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dihexylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dihexylbenzimidazole?
The IUPAC name of 2,2-dihexylbenzimidazole (CID 20537646) is 2,2-dihexylbenzimidazole.
What is the SMILES notation for 2,2-dihexylbenzimidazole?
The canonical SMILES for 2,2-dihexylbenzimidazole is CCCCCCC1(CCCCCC)N=c2ccccc2=N1.
What is the InChIKey of 2,2-dihexylbenzimidazole?
The InChIKey is IOUDMJJZSFBMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-3-5-7-11-15-19(16-12-8-6-4-2)20-17-13-9-10-14-18(17)21-19/h9-10,13-14H,3-8,11-12,15-16H2,1-2H3.
What are the key properties of 2,2-dihexylbenzimidazole?
2,2-dihexylbenzimidazole has a molecular weight of 286.46 g/mol, XLogP of 4.58, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dihexylbenzimidazole is sourced from PubChem (CID 20537646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).