About 4-butyl-2,2-dimethylbenzimidazole
4-butyl-2,2-dimethylbenzimidazole (PubChem CID 20537660) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-butyl-2,2-dimethylbenzimidazole.
Molecular Properties
| Compound Name | 4-butyl-2,2-dimethylbenzimidazole |
| PubChem CID | 20537660 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4-butyl-2,2-dimethylbenzimidazole |
| SMILES | CCCCc1cccc2c1=NC(C)(C)N=2 |
| InChI | InChI=1S/C13H18N2/c1-4-5-7-10-8-6-9-11-12(10)15-13(2,3)14-11/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | JQHFOVDBVMFDGF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butyl-2,2-dimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-2,2-dimethylbenzimidazole?
The IUPAC name of 4-butyl-2,2-dimethylbenzimidazole (CID 20537660) is 4-butyl-2,2-dimethylbenzimidazole.
What is the SMILES notation for 4-butyl-2,2-dimethylbenzimidazole?
The canonical SMILES for 4-butyl-2,2-dimethylbenzimidazole is CCCCc1cccc2c1=NC(C)(C)N=2.
What is the InChIKey of 4-butyl-2,2-dimethylbenzimidazole?
The InChIKey is JQHFOVDBVMFDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-4-5-7-10-8-6-9-11-12(10)15-13(2,3)14-11/h6,8-9H,4-5,7H2,1-3H3.
What are the key properties of 4-butyl-2,2-dimethylbenzimidazole?
4-butyl-2,2-dimethylbenzimidazole has a molecular weight of 202.30 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-2,2-dimethylbenzimidazole is sourced from PubChem (CID 20537660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).