About 5-methylspiro[benzimidazole-2,1'-cyclohexane]
5-methylspiro[benzimidazole-2,1'-cyclohexane] (PubChem CID 20537702) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 5-methylspiro[benzimidazole-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 5-methylspiro[benzimidazole-2,1'-cyclohexane] |
| PubChem CID | 20537702 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5-methylspiro[benzimidazole-2,1'-cyclohexane] |
| SMILES | Cc1ccc2c(c1)=NC1(CCCCC1)N=2 |
| InChI | InChI=1S/C13H16N2/c1-10-5-6-11-12(9-10)15-13(14-11)7-3-2-4-8-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | LYKOSWCTXIGYQZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylspiro[benzimidazole-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylspiro[benzimidazole-2,1'-cyclohexane]?
The IUPAC name of 5-methylspiro[benzimidazole-2,1'-cyclohexane] (CID 20537702) is 5-methylspiro[benzimidazole-2,1'-cyclohexane].
What is the SMILES notation for 5-methylspiro[benzimidazole-2,1'-cyclohexane]?
The canonical SMILES for 5-methylspiro[benzimidazole-2,1'-cyclohexane] is Cc1ccc2c(c1)=NC1(CCCCC1)N=2.
What is the InChIKey of 5-methylspiro[benzimidazole-2,1'-cyclohexane]?
The InChIKey is LYKOSWCTXIGYQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-10-5-6-11-12(9-10)15-13(14-11)7-3-2-4-8-13/h5-6,9H,2-4,7-8H2,1H3.
What are the key properties of 5-methylspiro[benzimidazole-2,1'-cyclohexane]?
5-methylspiro[benzimidazole-2,1'-cyclohexane] has a molecular weight of 200.29 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylspiro[benzimidazole-2,1'-cyclohexane] is sourced from PubChem (CID 20537702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).