About 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine
5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine (PubChem CID 20537770) has the molecular formula C31H46N4S
and a molecular weight of 506.80 g/mol. Its IUPAC name is 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine |
| PubChem CID | 20537770 |
| Molecular Formula | C31H46N4S |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2C)c2sc(N(CC)CC)nc2C)c(C)c1 |
| InChI | InChI=1S/C31H46N4S/c1-10-33(11-2)25-16-18-27(22(7)20-25)29(30-24(9)32-31(36-30)35(14-5)15-6)28-19-17-26(21-23(28)8)34(12-3)13-4/h16-21,29H,10-15H2,1-9H3 |
| InChIKey | MCDNQZGTJXGUSY-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine?
The IUPAC name of 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine (CID 20537770) is 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine is CCN(CC)c1ccc(C(c2ccc(N(CC)CC)cc2C)c2sc(N(CC)CC)nc2C)c(C)c1.
What is the InChIKey of 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine?
The InChIKey is MCDNQZGTJXGUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H46N4S/c1-10-33(11-2)25-16-18-27(22(7)20-25)29(30-24(9)32-31(36-30)35(14-5)15-6)28-19-17-26(21-23(28)8)34(12-3)13-4/h16-21,29H,10-15H2,1-9H3.
What are the key properties of 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine?
5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine has a molecular weight of 506.80 g/mol, XLogP of 7.79, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bis[4-(diethylamino)-2-methylphenyl]methyl]-N,N-diethyl-4-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 20537770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).