About 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline
3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline (PubChem CID 20537794) has the molecular formula C35H50N2O2
and a molecular weight of 530.80 g/mol. Its IUPAC name is 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline |
| PubChem CID | 20537794 |
| Molecular Formula | C35H50N2O2 |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.39 |
| IUPAC Name | 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline |
| SMILES | CCCCOc1cc(N(CC)CC)ccc1-c1cccc(C)c1-c1ccc(N(CC)CC)cc1OCCCC |
| InChI | InChI=1S/C35H50N2O2/c1-8-14-23-38-33-25-28(36(10-3)11-4)19-21-30(33)31-18-16-17-27(7)35(31)32-22-20-29(37(12-5)13-6)26-34(32)39-24-15-9-2/h16-22,25-26H,8-15,23-24H2,1-7H3 |
| InChIKey | SEFOBVMFTGOIIJ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline?
The IUPAC name of 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline (CID 20537794) is 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline.
What is the SMILES notation for 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline?
The canonical SMILES for 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline is CCCCOc1cc(N(CC)CC)ccc1-c1cccc(C)c1-c1ccc(N(CC)CC)cc1OCCCC.
What is the InChIKey of 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline?
The InChIKey is SEFOBVMFTGOIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H50N2O2/c1-8-14-23-38-33-25-28(36(10-3)11-4)19-21-30(33)31-18-16-17-27(7)35(31)32-22-20-29(37(12-5)13-6)26-34(32)39-24-15-9-2/h16-22,25-26H,8-15,23-24H2,1-7H3.
What are the key properties of 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline?
3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline has a molecular weight of 530.80 g/mol, XLogP of 9.38, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-4-[2-[2-butoxy-4-(diethylamino)phenyl]-3-methylphenyl]-N,N-diethylaniline is sourced from PubChem (CID 20537794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).