C12H9N3O2 — CID 20537803
(Z)-2,3-dicyano-3-[4-(methylamino)phenyl]prop-2-enoic acid (PubChem CID 20537803) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is (Z)-2,3-dicyano-3-[4-(methylamino)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2,3-dicyano-3-[4-(methylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 20537803 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (Z)-2,3-dicyano-3-[4-(methylamino)phenyl]prop-2-enoic acid |
| SMILES | CNc1ccc(/C(C#N)=C(\C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C12H9N3O2/c1-15-9-4-2-8(3-5-9)10(6-13)11(7-14)12(16)17/h2-5,15H,1H3,(H,16,17)/b11-10+ |
| InChIKey | FODHLSHYBVAXCR-ZHACJKMWSA-N |
| XLogP | 1.61 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|