C10H10N2O4S3 — CID 2053788
N-(4-sulfamoylphenyl)thiophene-2-sulfonamide (PubChem CID 2053788) has the molecular formula C10H10N2O4S3 and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(4-sulfamoylphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2053788 |
| Molecular Formula | C10H10N2O4S3 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | N-(4-sulfamoylphenyl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C10H10N2O4S3/c11-18(13,14)9-5-3-8(4-6-9)12-19(15,16)10-2-1-7-17-10/h1-7,12H,(H2,11,13,14) |
| InChIKey | XOJZHWXWJNOPEN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |