About (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid
(4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid (PubChem CID 20537925) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid.
Molecular Properties
| Compound Name | (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid |
| PubChem CID | 20537925 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid |
| SMILES | CC1SC(C)C(C(=O)O)/C1=N/O |
| InChI | InChI=1S/C7H11NO3S/c1-3-5(7(9)10)6(8-11)4(2)12-3/h3-5,11H,1-2H3,(H,9,10)/b8-6+ |
| InChIKey | HHVDDINYYZFRBC-SOFGYWHQSA-N |
| XLogP | 1.04 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid?
The IUPAC name of (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid (CID 20537925) is (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid.
What is the SMILES notation for (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid?
The canonical SMILES for (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid is CC1SC(C)C(C(=O)O)/C1=N/O.
What is the InChIKey of (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid?
The InChIKey is HHVDDINYYZFRBC-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-3-5(7(9)10)6(8-11)4(2)12-3/h3-5,11H,1-2H3,(H,9,10)/b8-6+.
What are the key properties of (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid?
(4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid has a molecular weight of 189.24 g/mol, XLogP of 1.04, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hydroxyimino-2,5-dimethylthiolane-3-carboxylic acid is sourced from PubChem (CID 20537925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).