C9H15N9S2 — CID 20537938
1-cyano-3-[2-[[5-(diaminomethylideneamino)-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]-2-methylguanidine (PubChem CID 20537938) has the molecular formula C9H15N9S2 and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-cyano-3-[2-[[5-(diaminomethylideneamino)-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]-2-methylguanidine.
| Compound Name | 1-cyano-3-[2-[[5-(diaminomethylideneamino)-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 20537938 |
| Molecular Formula | C9H15N9S2 |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-cyano-3-[2-[[5-(diaminomethylideneamino)-1,2,4-thiadiazol-3-yl]methylsulfanyl]ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1nsc(N=C(N)N)n1 |
| InChI | InChI=1S/C9H15N9S2/c1-13-8(15-5-10)14-2-3-19-4-6-16-9(20-18-6)17-7(11)12/h2-4H2,1H3,(H2,13,14,15)(H4,11,12,16,17,18) |
| InChIKey | QLXYXDYEGPBKGC-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|