C20H34N2 — CID 2053830
N,N,N'-triethyl-N'-(4-phenylcyclohexyl)ethane-1,2-diamine (PubChem CID 2053830) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-(4-phenylcyclohexyl)ethane-1,2-diamine.
| Compound Name | N,N,N'-triethyl-N'-(4-phenylcyclohexyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 2053830 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | N,N,N'-triethyl-N'-(4-phenylcyclohexyl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCN(CC)C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H34N2/c1-4-21(5-2)16-17-22(6-3)20-14-12-19(13-15-20)18-10-8-7-9-11-18/h7-11,19-20H,4-6,12-17H2,1-3H3 |
| InChIKey | YHJHAUCEPJCWQN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |