C17H37N3O — CID 20538481
N-[2-(2-aminoethoxy)ethyl]-2,2,6,6-tetraethylpiperidin-4-amine (PubChem CID 20538481) has the molecular formula C17H37N3O and a molecular weight of 299.50 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-2,2,6,6-tetraethylpiperidin-4-amine.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-2,2,6,6-tetraethylpiperidin-4-amine |
|---|---|
| PubChem CID | 20538481 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-2,2,6,6-tetraethylpiperidin-4-amine |
| SMILES | CCC1(CC)CC(NCCOCCN)CC(CC)(CC)N1 |
| InChI | InChI=1S/C17H37N3O/c1-5-16(6-2)13-15(19-10-12-21-11-9-18)14-17(7-3,8-4)20-16/h15,19-20H,5-14,18H2,1-4H3 |
| InChIKey | RRCJVOWHSZDUEG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|