About 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine
2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine (PubChem CID 20538545) has the molecular formula C10H24N2S2
and a molecular weight of 236.45 g/mol. Its IUPAC name is 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine.
Molecular Properties
| Compound Name | 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine |
| PubChem CID | 20538545 |
| Molecular Formula | C10H24N2S2 |
| Molecular Weight | 236.45 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine |
| SMILES | CCSCCCCCCSCC(N)N |
| InChI | InChI=1S/C10H24N2S2/c1-2-13-7-5-3-4-6-8-14-9-10(11)12/h10H,2-9,11-12H2,1H3 |
| InChIKey | GEHPKMJTANMXOQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine?
The IUPAC name of 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine (CID 20538545) is 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine.
What is the SMILES notation for 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine?
The canonical SMILES for 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine is CCSCCCCCCSCC(N)N.
What is the InChIKey of 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine?
The InChIKey is GEHPKMJTANMXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2S2/c1-2-13-7-5-3-4-6-8-14-9-10(11)12/h10H,2-9,11-12H2,1H3.
What are the key properties of 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine?
2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine has a molecular weight of 236.45 g/mol, XLogP of 2.28, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-ethylsulfanylhexylsulfanyl)ethane-1,1-diamine is sourced from PubChem (CID 20538545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).