C10H6ClF7 — CID 20538771
1-(chloromethyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene (PubChem CID 20538771) has the molecular formula C10H6ClF7 and a molecular weight of 294.60 g/mol. Its IUPAC name is 1-(chloromethyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene.
| Compound Name | 1-(chloromethyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 20538771 |
| Molecular Formula | C10H6ClF7 |
| Molecular Weight | 294.60 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 1-(chloromethyl)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzene |
| SMILES | FC(F)(F)C(F)(c1ccc(CCl)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF7/c11-5-6-1-3-7(4-2-6)8(12,9(13,14)15)10(16,17)18/h1-4H,5H2 |
| InChIKey | YVFMXVCWQRNPID-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|