About 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid
2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid (PubChem CID 2053933) has the molecular formula C16H13NO4
and a molecular weight of 283.28 g/mol. Its IUPAC name is 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid |
| PubChem CID | 2053933 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid |
| SMILES | O=C1CCCc2c1cc(C(=O)O)c(=O)n2-c1ccccc1 |
| InChI | InChI=1S/C16H13NO4/c18-14-8-4-7-13-11(14)9-12(16(20)21)15(19)17(13)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,20,21) |
| InChIKey | FJSNSFADDNXWFS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid?
The IUPAC name of 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid (CID 2053933) is 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid.
What is the SMILES notation for 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid?
The canonical SMILES for 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid is O=C1CCCc2c1cc(C(=O)O)c(=O)n2-c1ccccc1.
What is the InChIKey of 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid?
The InChIKey is FJSNSFADDNXWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO4/c18-14-8-4-7-13-11(14)9-12(16(20)21)15(19)17(13)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,20,21).
What are the key properties of 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid?
2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid has a molecular weight of 283.28 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxylic acid is sourced from PubChem (CID 2053933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).