About [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate
[9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate (PubChem CID 20539893) has the molecular formula C20H34O5
and a molecular weight of 354.49 g/mol. Its IUPAC name is [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate.
Molecular Properties
| Compound Name | [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate |
| PubChem CID | 20539893 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate |
| SMILES | C=C(C)CCC(OC(C)=O)C(C)CCCC1OCC2(OC)CCC1O2 |
| InChI | InChI=1S/C20H34O5/c1-14(2)9-10-17(24-16(4)21)15(3)7-6-8-18-19-11-12-20(22-5,25-19)13-23-18/h15,17-19H,1,6-13H2,2-5H3 |
| InChIKey | NEMYSKZKJOHENA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate?
The IUPAC name of [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate (CID 20539893) is [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate.
What is the SMILES notation for [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate?
The canonical SMILES for [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate is C=C(C)CCC(OC(C)=O)C(C)CCCC1OCC2(OC)CCC1O2.
What is the InChIKey of [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate?
The InChIKey is NEMYSKZKJOHENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O5/c1-14(2)9-10-17(24-16(4)21)15(3)7-6-8-18-19-11-12-20(22-5,25-19)13-23-18/h15,17-19H,1,6-13H2,2-5H3.
What are the key properties of [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate?
[9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate has a molecular weight of 354.49 g/mol, XLogP of 4.00, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(5-methoxy-3,8-dioxabicyclo[3.2.1]octan-2-yl)-2,6-dimethylnon-1-en-5-yl] acetate is sourced from PubChem (CID 20539893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).