C20H23NO2S — CID 20539984
1-methyl-6-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydroquinolin-2-one (PubChem CID 20539984) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-methyl-6-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-6-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 20539984 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-methyl-6-(4-phenyl-1-sulfanylbutoxy)-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(OC(S)CCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H23NO2S/c1-21-18-12-11-17(14-16(18)10-13-19(21)22)23-20(24)9-5-8-15-6-3-2-4-7-15/h2-4,6-7,11-12,14,20,24H,5,8-10,13H2,1H3 |
| InChIKey | QSHBHVNWKPYCIN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|