About butyl 4-chlorobenzenesulfonate
butyl 4-chlorobenzenesulfonate (PubChem CID 20540109) has the molecular formula C10H13ClO3S
and a molecular weight of 248.73 g/mol. Its IUPAC name is butyl 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | butyl 4-chlorobenzenesulfonate |
| PubChem CID | 20540109 |
| Molecular Formula | C10H13ClO3S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | butyl 4-chlorobenzenesulfonate |
| SMILES | CCCCOS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClO3S/c1-2-3-8-14-15(12,13)10-6-4-9(11)5-7-10/h4-7H,2-3,8H2,1H3 |
| InChIKey | TXCVGKYRYDFKRW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-chlorobenzenesulfonate?
The IUPAC name of butyl 4-chlorobenzenesulfonate (CID 20540109) is butyl 4-chlorobenzenesulfonate.
What is the SMILES notation for butyl 4-chlorobenzenesulfonate?
The canonical SMILES for butyl 4-chlorobenzenesulfonate is CCCCOS(=O)(=O)c1ccc(Cl)cc1.
What is the InChIKey of butyl 4-chlorobenzenesulfonate?
The InChIKey is TXCVGKYRYDFKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO3S/c1-2-3-8-14-15(12,13)10-6-4-9(11)5-7-10/h4-7H,2-3,8H2,1H3.
What are the key properties of butyl 4-chlorobenzenesulfonate?
butyl 4-chlorobenzenesulfonate has a molecular weight of 248.73 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-chlorobenzenesulfonate is sourced from PubChem (CID 20540109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).