About 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride
8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride (PubChem CID 20540206) has the molecular formula C15H16ClFO3
and a molecular weight of 298.74 g/mol. Its IUPAC name is 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride.
Molecular Properties
| Compound Name | 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride |
| PubChem CID | 20540206 |
| Molecular Formula | C15H16ClFO3 |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride |
| SMILES | O=C(Cl)C1(c2ccc(F)cc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H16ClFO3/c16-13(18)14(11-1-3-12(17)4-2-11)5-7-15(8-6-14)19-9-10-20-15/h1-4H,5-10H2 |
| InChIKey | PEDRXIMDCUCXPG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
The IUPAC name of 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride (CID 20540206) is 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride.
What is the SMILES notation for 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
The canonical SMILES for 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride is O=C(Cl)C1(c2ccc(F)cc2)CCC2(CC1)OCCO2.
What is the InChIKey of 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
The InChIKey is PEDRXIMDCUCXPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClFO3/c16-13(18)14(11-1-3-12(17)4-2-11)5-7-15(8-6-14)19-9-10-20-15/h1-4H,5-10H2.
What are the key properties of 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride?
8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride has a molecular weight of 298.74 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decane-8-carbonyl chloride is sourced from PubChem (CID 20540206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).