About 3,3-diethoxy-N,N-dimethylpropan-1-amine
3,3-diethoxy-N,N-dimethylpropan-1-amine (PubChem CID 20540449) has the molecular formula C9H21NO2
and a molecular weight of 175.27 g/mol. Its IUPAC name is 3,3-diethoxy-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3,3-diethoxy-N,N-dimethylpropan-1-amine |
| PubChem CID | 20540449 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 3,3-diethoxy-N,N-dimethylpropan-1-amine |
| SMILES | CCOC(CCN(C)C)OCC |
| InChI | InChI=1S/C9H21NO2/c1-5-11-9(12-6-2)7-8-10(3)4/h9H,5-8H2,1-4H3 |
| InChIKey | YNVCGLCZEGMEOS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxy-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxy-N,N-dimethylpropan-1-amine?
The IUPAC name of 3,3-diethoxy-N,N-dimethylpropan-1-amine (CID 20540449) is 3,3-diethoxy-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3,3-diethoxy-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3,3-diethoxy-N,N-dimethylpropan-1-amine is CCOC(CCN(C)C)OCC.
What is the InChIKey of 3,3-diethoxy-N,N-dimethylpropan-1-amine?
The InChIKey is YNVCGLCZEGMEOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21NO2/c1-5-11-9(12-6-2)7-8-10(3)4/h9H,5-8H2,1-4H3.
What are the key properties of 3,3-diethoxy-N,N-dimethylpropan-1-amine?
3,3-diethoxy-N,N-dimethylpropan-1-amine has a molecular weight of 175.27 g/mol, XLogP of 1.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxy-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 20540449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).