About 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate
3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate (PubChem CID 20540482) has the molecular formula C21H12F3IO4
and a molecular weight of 512.22 g/mol. Its IUPAC name is 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate |
| PubChem CID | 20540482 |
| Molecular Formula | C21H12F3IO4 |
| Molecular Weight | 512.22 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate |
| SMILES | O=C(Oc1ccccc1I)c1cccc(C(=O)Oc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C21H12F3IO4/c22-21(23,24)15-8-1-3-10-17(15)28-19(26)13-6-5-7-14(12-13)20(27)29-18-11-4-2-9-16(18)25/h1-12H |
| InChIKey | SNEFSRKJNQMPCL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.22 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate?
The IUPAC name of 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate (CID 20540482) is 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate.
What is the SMILES notation for 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate?
The canonical SMILES for 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate is O=C(Oc1ccccc1I)c1cccc(C(=O)Oc2ccccc2C(F)(F)F)c1.
What is the InChIKey of 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate?
The InChIKey is SNEFSRKJNQMPCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12F3IO4/c22-21(23,24)15-8-1-3-10-17(15)28-19(26)13-6-5-7-14(12-13)20(27)29-18-11-4-2-9-16(18)25/h1-12H.
What are the key properties of 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate?
3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate has a molecular weight of 512.22 g/mol, XLogP of 5.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(2-iodophenyl) 1-O-[2-(trifluoromethyl)phenyl] benzene-1,3-dicarboxylate is sourced from PubChem (CID 20540482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).