About 1,2-benzothiazonine
1,2-benzothiazonine (PubChem CID 20541342) has the molecular formula C11H9NS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 1,2-benzothiazonine.
Molecular Properties
| Compound Name | 1,2-benzothiazonine |
| PubChem CID | 20541342 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 1,2-benzothiazonine |
| SMILES | c1ccnsc2ccccc2cc1 |
| InChI | InChI=1S/C11H9NS/c1-2-6-10-7-3-4-8-11(10)13-12-9-5-1/h1-9H/b5-1-,6-2-,12-9- |
| InChIKey | RLGZEQUGQKBBLO-SCBVRIFCSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-benzothiazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-benzothiazonine?
The IUPAC name of 1,2-benzothiazonine (CID 20541342) is 1,2-benzothiazonine.
What is the SMILES notation for 1,2-benzothiazonine?
The canonical SMILES for 1,2-benzothiazonine is c1ccnsc2ccccc2cc1.
What is the InChIKey of 1,2-benzothiazonine?
The InChIKey is RLGZEQUGQKBBLO-SCBVRIFCSA-N. The full InChI is InChI=1S/C11H9NS/c1-2-6-10-7-3-4-8-11(10)13-12-9-5-1/h1-9H/b5-1-,6-2-,12-9-.
What are the key properties of 1,2-benzothiazonine?
1,2-benzothiazonine has a molecular weight of 187.27 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-benzothiazonine is sourced from PubChem (CID 20541342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).