About 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine
3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine (PubChem CID 20541458) has the molecular formula C14H32N2O2
and a molecular weight of 260.42 g/mol. Its IUPAC name is 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine |
| PubChem CID | 20541458 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine |
| SMILES | CCC(C)(CC(C)(C)OCCCN)OCCCN |
| InChI | InChI=1S/C14H32N2O2/c1-5-14(4,18-11-7-9-16)12-13(2,3)17-10-6-8-15/h5-12,15-16H2,1-4H3 |
| InChIKey | NRPAUQNGEWEYIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine?
The IUPAC name of 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine (CID 20541458) is 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine.
What is the SMILES notation for 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine?
The canonical SMILES for 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine is CCC(C)(CC(C)(C)OCCCN)OCCCN.
What is the InChIKey of 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine?
The InChIKey is NRPAUQNGEWEYIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32N2O2/c1-5-14(4,18-11-7-9-16)12-13(2,3)17-10-6-8-15/h5-12,15-16H2,1-4H3.
What are the key properties of 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine?
3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine has a molecular weight of 260.42 g/mol, XLogP of 2.05, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-aminopropoxy)-2,4-dimethylhexan-2-yl]oxypropan-1-amine is sourced from PubChem (CID 20541458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).