About 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one
2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one (PubChem CID 20541539) has the molecular formula C19H30O6
and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one |
| PubChem CID | 20541539 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one |
| SMILES | COC(C)OC1C=C(/C=C/CCCCC(=O)CC(OC)OC)C(=O)C1 |
| InChI | InChI=1S/C19H30O6/c1-14(22-2)25-17-11-15(18(21)13-17)9-7-5-6-8-10-16(20)12-19(23-3)24-4/h7,9,11,14,17,19H,5-6,8,10,12-13H2,1-4H3/b9-7+ |
| InChIKey | NLIJUINZMODZEX-VQHVLOKHSA-N |
| XLogP | 2.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one?
The IUPAC name of 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one (CID 20541539) is 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one.
What is the SMILES notation for 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one?
The canonical SMILES for 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one is COC(C)OC1C=C(/C=C/CCCCC(=O)CC(OC)OC)C(=O)C1.
What is the InChIKey of 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one?
The InChIKey is NLIJUINZMODZEX-VQHVLOKHSA-N. The full InChI is InChI=1S/C19H30O6/c1-14(22-2)25-17-11-15(18(21)13-17)9-7-5-6-8-10-16(20)12-19(23-3)24-4/h7,9,11,14,17,19H,5-6,8,10,12-13H2,1-4H3/b9-7+.
What are the key properties of 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one?
2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one has a molecular weight of 354.44 g/mol, XLogP of 2.96, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-9,9-dimethoxy-7-oxonon-1-enyl]-4-(1-methoxyethoxy)cyclopent-2-en-1-one is sourced from PubChem (CID 20541539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).