C10H10O4-2 — CID 2054184
(1R,2R,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 2054184) has the molecular formula C10H10O4-2 and a molecular weight of 194.19 g/mol. Its IUPAC name is (1R,2R,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | (1R,2R,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 2054184 |
| Molecular Formula | C10H10O4-2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (1R,2R,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | O=C([O-])[C@H]1[C@H](C(=O)[O-])[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C10H12O4/c11-9(12)7-5-1-2-6(4-3-5)8(7)10(13)14/h1-2,5-8H,3-4H2,(H,11,12)(H,13,14)/p-2/t5-,6+,7-,8-/m1/s1 |
| InChIKey | FUBZERMWPMTSEB-ULAWRXDQSA-L |
| XLogP | -1.69 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|