C17H22ClNO2 — CID 20541877
6-(2-piperidin-1-ylethyl)naphthalene-2,3-diol;hydrochloride (PubChem CID 20541877) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 6-(2-piperidin-1-ylethyl)naphthalene-2,3-diol;hydrochloride.
| Compound Name | 6-(2-piperidin-1-ylethyl)naphthalene-2,3-diol;hydrochloride |
|---|---|
| PubChem CID | 20541877 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 6-(2-piperidin-1-ylethyl)naphthalene-2,3-diol;hydrochloride |
| SMILES | Cl.Oc1cc2ccc(CCN3CCCCC3)cc2cc1O |
| InChI | InChI=1S/C17H21NO2.ClH/c19-16-11-14-5-4-13(10-15(14)12-17(16)20)6-9-18-7-2-1-3-8-18;/h4-5,10-12,19-20H,1-3,6-9H2;1H |
| InChIKey | VRRHVFDRBKUSEK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|