C35H31NO4 — CID 20541928
[6-[2-(benzylamino)ethyl]-3-(4-methylbenzoyl)oxynaphthalen-2-yl] 4-methylbenzoate (PubChem CID 20541928) has the molecular formula C35H31NO4 and a molecular weight of 529.64 g/mol. Its IUPAC name is [6-[2-(benzylamino)ethyl]-3-(4-methylbenzoyl)oxynaphthalen-2-yl] 4-methylbenzoate.
| Compound Name | [6-[2-(benzylamino)ethyl]-3-(4-methylbenzoyl)oxynaphthalen-2-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 20541928 |
| Molecular Formula | C35H31NO4 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | [6-[2-(benzylamino)ethyl]-3-(4-methylbenzoyl)oxynaphthalen-2-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc3ccc(CCNCc4ccccc4)cc3cc2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C35H31NO4/c1-24-8-13-28(14-9-24)34(37)39-32-21-30-17-12-26(18-19-36-23-27-6-4-3-5-7-27)20-31(30)22-33(32)40-35(38)29-15-10-25(2)11-16-29/h3-17,20-22,36H,18-19,23H2,1-2H3 |
| InChIKey | DSSZETNFTGUNDA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|