C19H17FN2O2 — CID 20542077
7-acetyl-1-ethyl-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one (PubChem CID 20542077) has the molecular formula C19H17FN2O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is 7-acetyl-1-ethyl-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one.
| Compound Name | 7-acetyl-1-ethyl-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 20542077 |
| Molecular Formula | C19H17FN2O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 7-acetyl-1-ethyl-5-(2-fluorophenyl)-3H-1,4-benzodiazepin-2-one |
| SMILES | CCN1C(=O)CN=C(c2ccccc2F)c2cc(C(C)=O)ccc21 |
| InChI | InChI=1S/C19H17FN2O2/c1-3-22-17-9-8-13(12(2)23)10-15(17)19(21-11-18(22)24)14-6-4-5-7-16(14)20/h4-10H,3,11H2,1-2H3 |
| InChIKey | SNRTUGPOMGJTGB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |