About 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one
1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one (PubChem CID 20542345) has the molecular formula C20H22O3
and a molecular weight of 310.39 g/mol. Its IUPAC name is 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one.
Molecular Properties
| Compound Name | 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one |
| PubChem CID | 20542345 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one |
| SMILES | CC(C)c1ccc2c(c1O)C(=O)c1c(ccc(C(C)C)c1O)C2 |
| InChI | InChI=1S/C20H22O3/c1-10(2)14-7-5-12-9-13-6-8-15(11(3)4)19(22)17(13)20(23)16(12)18(14)21/h5-8,10-11,21-22H,9H2,1-4H3 |
| InChIKey | WXYZAWRACLNXEH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one?
The IUPAC name of 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one (CID 20542345) is 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one.
What is the SMILES notation for 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one?
The canonical SMILES for 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one is CC(C)c1ccc2c(c1O)C(=O)c1c(ccc(C(C)C)c1O)C2.
What is the InChIKey of 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one?
The InChIKey is WXYZAWRACLNXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O3/c1-10(2)14-7-5-12-9-13-6-8-15(11(3)4)19(22)17(13)20(23)16(12)18(14)21/h5-8,10-11,21-22H,9H2,1-4H3.
What are the key properties of 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one?
1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one has a molecular weight of 310.39 g/mol, XLogP of 4.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dihydroxy-2,7-di(propan-2-yl)-10H-anthracen-9-one is sourced from PubChem (CID 20542345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).