About ethyl tris(2-ethylhexyl) silicate
ethyl tris(2-ethylhexyl) silicate (PubChem CID 20542505) has the molecular formula C26H56O4Si
and a molecular weight of 460.82 g/mol. Its IUPAC name is ethyl tris(2-ethylhexyl) silicate.
Molecular Properties
| Compound Name | ethyl tris(2-ethylhexyl) silicate |
| PubChem CID | 20542505 |
| Molecular Formula | C26H56O4Si |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | ethyl tris(2-ethylhexyl) silicate |
| SMILES | CCCCC(CC)CO[Si](OCC)(OCC(CC)CCCC)OCC(CC)CCCC |
| InChI | InChI=1S/C26H56O4Si/c1-8-15-18-24(11-4)21-28-31(27-14-7,29-22-25(12-5)19-16-9-2)30-23-26(13-6)20-17-10-3/h24-26H,8-23H2,1-7H3 |
| InChIKey | BCHMLKPTNNTFAY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl tris(2-ethylhexyl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl tris(2-ethylhexyl) silicate?
The IUPAC name of ethyl tris(2-ethylhexyl) silicate (CID 20542505) is ethyl tris(2-ethylhexyl) silicate.
What is the SMILES notation for ethyl tris(2-ethylhexyl) silicate?
The canonical SMILES for ethyl tris(2-ethylhexyl) silicate is CCCCC(CC)CO[Si](OCC)(OCC(CC)CCCC)OCC(CC)CCCC.
What is the InChIKey of ethyl tris(2-ethylhexyl) silicate?
The InChIKey is BCHMLKPTNNTFAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H56O4Si/c1-8-15-18-24(11-4)21-28-31(27-14-7,29-22-25(12-5)19-16-9-2)30-23-26(13-6)20-17-10-3/h24-26H,8-23H2,1-7H3.
What are the key properties of ethyl tris(2-ethylhexyl) silicate?
ethyl tris(2-ethylhexyl) silicate has a molecular weight of 460.82 g/mol, XLogP of 8.16, 23 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl tris(2-ethylhexyl) silicate is sourced from PubChem (CID 20542505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).