About 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid
2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid (PubChem CID 20542731) has the molecular formula C23H24N2O2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid |
| PubChem CID | 20542731 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid |
| SMILES | O=C(O)Cc1c(C2CCCCC2)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H24N2O2/c26-21(27)16-20-22(17-10-4-1-5-11-17)24-25(19-14-8-3-9-15-19)23(20)18-12-6-2-7-13-18/h2-3,6-9,12-15,17H,1,4-5,10-11,16H2,(H,26,27) |
| InChIKey | QGOVUUCDVMVZEX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid?
The IUPAC name of 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid (CID 20542731) is 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid.
What is the SMILES notation for 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid?
The canonical SMILES for 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid is O=C(O)Cc1c(C2CCCCC2)nn(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid?
The InChIKey is QGOVUUCDVMVZEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O2/c26-21(27)16-20-22(17-10-4-1-5-11-17)24-25(19-14-8-3-9-15-19)23(20)18-12-6-2-7-13-18/h2-3,6-9,12-15,17H,1,4-5,10-11,16H2,(H,26,27).
What are the key properties of 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid?
2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid has a molecular weight of 360.46 g/mol, XLogP of 5.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclohexyl-1,5-diphenylpyrazol-4-yl)acetic acid is sourced from PubChem (CID 20542731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).