About 4-ethoxy-3-methylaniline
4-ethoxy-3-methylaniline (PubChem CID 20543248) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-ethoxy-3-methylaniline.
Molecular Properties
| Compound Name | 4-ethoxy-3-methylaniline |
| PubChem CID | 20543248 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-ethoxy-3-methylaniline |
| SMILES | CCOc1ccc(N)cc1C |
| InChI | InChI=1S/C9H13NO/c1-3-11-9-5-4-8(10)6-7(9)2/h4-6H,3,10H2,1-2H3 |
| InChIKey | AEOOTFBLNLIOJB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethoxy-3-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-3-methylaniline?
The IUPAC name of 4-ethoxy-3-methylaniline (CID 20543248) is 4-ethoxy-3-methylaniline.
What is the SMILES notation for 4-ethoxy-3-methylaniline?
The canonical SMILES for 4-ethoxy-3-methylaniline is CCOc1ccc(N)cc1C.
What is the InChIKey of 4-ethoxy-3-methylaniline?
The InChIKey is AEOOTFBLNLIOJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-3-11-9-5-4-8(10)6-7(9)2/h4-6H,3,10H2,1-2H3.
What are the key properties of 4-ethoxy-3-methylaniline?
4-ethoxy-3-methylaniline has a molecular weight of 151.21 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-3-methylaniline is sourced from PubChem (CID 20543248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).