About 3-butylazetidin-3-ol
3-butylazetidin-3-ol (PubChem CID 20544161) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 3-butylazetidin-3-ol.
Molecular Properties
| Compound Name | 3-butylazetidin-3-ol |
| PubChem CID | 20544161 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 3-butylazetidin-3-ol |
| SMILES | CCCCC1(O)CNC1 |
| InChI | InChI=1S/C7H15NO/c1-2-3-4-7(9)5-8-6-7/h8-9H,2-6H2,1H3 |
| InChIKey | RWGUFKMIVBKLRU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butylazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butylazetidin-3-ol?
The IUPAC name of 3-butylazetidin-3-ol (CID 20544161) is 3-butylazetidin-3-ol.
What is the SMILES notation for 3-butylazetidin-3-ol?
The canonical SMILES for 3-butylazetidin-3-ol is CCCCC1(O)CNC1.
What is the InChIKey of 3-butylazetidin-3-ol?
The InChIKey is RWGUFKMIVBKLRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-2-3-4-7(9)5-8-6-7/h8-9H,2-6H2,1H3.
What are the key properties of 3-butylazetidin-3-ol?
3-butylazetidin-3-ol has a molecular weight of 129.20 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butylazetidin-3-ol is sourced from PubChem (CID 20544161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).