2-oxo-1,3-oxazolidine-3-carbonyl chloride

C4H4ClNO3 — CID 20544459

IUPAC2-oxo-1,3-oxazolidine-3-carbonyl chloride
SMILESO=C(Cl)N1CCOC1=O
InChIInChI=1S/C4H4ClNO3/c5-3(7)6-1-2-9-4(6)8/h1-2H2
InChIKeyOZJANYSOGASXNQ-UHFFFAOYSA-N
MW149.53 g/mol
LogP0.80
Rot. Bonds

About 2-oxo-1,3-oxazolidine-3-carbonyl chloride

2-oxo-1,3-oxazolidine-3-carbonyl chloride (PubChem CID 20544459) has the molecular formula C4H4ClNO3 and a molecular weight of 149.53 g/mol. Its IUPAC name is 2-oxo-1,3-oxazolidine-3-carbonyl chloride.

Molecular Properties

Compound Name2-oxo-1,3-oxazolidine-3-carbonyl chloride
PubChem CID20544459
Molecular FormulaC4H4ClNO3
Molecular Weight149.53 g/mol
Exact Mass148.99
IUPAC Name2-oxo-1,3-oxazolidine-3-carbonyl chloride
SMILESO=C(Cl)N1CCOC1=O
InChIInChI=1S/C4H4ClNO3/c5-3(7)6-1-2-9-4(6)8/h1-2H2
InChIKeyOZJANYSOGASXNQ-UHFFFAOYSA-N
XLogP0.80
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.53
LogP ≤ 50.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze 2-oxo-1,3-oxazolidine-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxo-1,3-oxazolidine-3-carbonyl chloride?
The IUPAC name of 2-oxo-1,3-oxazolidine-3-carbonyl chloride (CID 20544459) is 2-oxo-1,3-oxazolidine-3-carbonyl chloride.
What is the SMILES notation for 2-oxo-1,3-oxazolidine-3-carbonyl chloride?
The canonical SMILES for 2-oxo-1,3-oxazolidine-3-carbonyl chloride is O=C(Cl)N1CCOC1=O.
What is the InChIKey of 2-oxo-1,3-oxazolidine-3-carbonyl chloride?
The InChIKey is OZJANYSOGASXNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClNO3/c5-3(7)6-1-2-9-4(6)8/h1-2H2.
What are the key properties of 2-oxo-1,3-oxazolidine-3-carbonyl chloride?
2-oxo-1,3-oxazolidine-3-carbonyl chloride has a molecular weight of 149.53 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,3-oxazolidine-3-carbonyl chloride is sourced from PubChem (CID 20544459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).