About ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate
ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate (PubChem CID 20544481) has the molecular formula C10H14O7
and a molecular weight of 246.21 g/mol. Its IUPAC name is ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate.
Molecular Properties
| Compound Name | ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate |
| PubChem CID | 20544481 |
| Molecular Formula | C10H14O7 |
| Molecular Weight | 246.21 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate |
| SMILES | CCOC(=O)COc1coc(CO)cc1=O.O |
| InChI | InChI=1S/C10H12O6.H2O/c1-2-14-10(13)6-16-9-5-15-7(4-11)3-8(9)12;/h3,5,11H,2,4,6H2,1H3;1H2 |
| InChIKey | FAWSYWXGRHOVFK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.21 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate?
The IUPAC name of ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate (CID 20544481) is ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate.
What is the SMILES notation for ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate?
The canonical SMILES for ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate is CCOC(=O)COc1coc(CO)cc1=O.O.
What is the InChIKey of ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate?
The InChIKey is FAWSYWXGRHOVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O6.H2O/c1-2-14-10(13)6-16-9-5-15-7(4-11)3-8(9)12;/h3,5,11H,2,4,6H2,1H3;1H2.
What are the key properties of ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate?
ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate has a molecular weight of 246.21 g/mol, XLogP of -0.75, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxyacetate;hydrate is sourced from PubChem (CID 20544481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).