C8H9NO3 — CID 20544632
(3-hydroxyphenyl)-methylcarbamic acid (PubChem CID 20544632) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is (3-hydroxyphenyl)-methylcarbamic acid.
| Compound Name | (3-hydroxyphenyl)-methylcarbamic acid |
|---|---|
| PubChem CID | 20544632 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (3-hydroxyphenyl)-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cccc(O)c1 |
| InChI | InChI=1S/C8H9NO3/c1-9(8(11)12)6-3-2-4-7(10)5-6/h2-5,10H,1H3,(H,11,12) |
| InChIKey | CVKKNJKDYRCBBE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |