About [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate
[3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate (PubChem CID 20545098) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate |
| PubChem CID | 20545098 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc(OC(=O)C(C)(C)C)cc(C(=O)C=O)c1 |
| InChI | InChI=1S/C18H22O6/c1-17(2,3)15(21)23-12-7-11(14(20)10-19)8-13(9-12)24-16(22)18(4,5)6/h7-10H,1-6H3 |
| InChIKey | MGYRBZSVSUEDMP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate?
The IUPAC name of [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate (CID 20545098) is [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate?
The canonical SMILES for [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)Oc1cc(OC(=O)C(C)(C)C)cc(C(=O)C=O)c1.
What is the InChIKey of [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate?
The InChIKey is MGYRBZSVSUEDMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O6/c1-17(2,3)15(21)23-12-7-11(14(20)10-19)8-13(9-12)24-16(22)18(4,5)6/h7-10H,1-6H3.
What are the key properties of [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate?
[3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate has a molecular weight of 334.37 g/mol, XLogP of 2.97, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-dimethylpropanoyloxy)-5-oxaldehydoylphenyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 20545098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).